C38H61N3O6 — CID 56680290
(2S,4S,5S,7S)-5-amino-N-[2,2-dimethyl-3-[(2-phenylacetyl)amino]propyl]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide (PubChem CID 56680290) has the molecular formula C38H61N3O6 and a molecular weight of 655.92 g/mol. Its IUPAC name is (2S,4S,5S,7S)-5-amino-N-[2,2-dimethyl-3-[(2-phenylacetyl)amino]propyl]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide.
| Compound Name | (2S,4S,5S,7S)-5-amino-N-[2,2-dimethyl-3-[(2-phenylacetyl)amino]propyl]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 56680290 |
| Molecular Formula | C38H61N3O6 |
| Molecular Weight | 655.92 g/mol |
| Exact Mass | 655.46 |
| IUPAC Name | (2S,4S,5S,7S)-5-amino-N-[2,2-dimethyl-3-[(2-phenylacetyl)amino]propyl]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@H](C(=O)NCC(C)(C)CNC(=O)Cc2ccccc2)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C38H61N3O6/c1-26(2)30(19-29-15-16-34(46-8)35(20-29)47-18-12-17-45-7)22-32(39)33(42)23-31(27(3)4)37(44)41-25-38(5,6)24-40-36(43)21-28-13-10-9-11-14-28/h9-11,13-16,20,26-27,30-33,42H,12,17-19,21-25,39H2,1-8H3,(H,40,43)(H,41,44)/t30-,31-,32-,33-/m0/s1 |
| InChIKey | DXQYZWIHQMCPAO-YRCZKMHPSA-N |
| XLogP | 5.17 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.92 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|