About 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine
3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine (PubChem CID 56680380) has the molecular formula C22H19N3O4S
and a molecular weight of 421.48 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine |
| PubChem CID | 56680380 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine |
| SMILES | COc1cc(Nc2nc3ccccc3nc2S(=O)(=O)c2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C22H19N3O4S/c1-28-16-12-15(13-17(14-16)29-2)23-21-22(25-20-11-7-6-10-19(20)24-21)30(26,27)18-8-4-3-5-9-18/h3-14H,1-2H3,(H,23,24) |
| InChIKey | WNKZWZLBYZKRLY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine?
The IUPAC name of 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine (CID 56680380) is 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine.
What is the SMILES notation for 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine?
The canonical SMILES for 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine is COc1cc(Nc2nc3ccccc3nc2S(=O)(=O)c2ccccc2)cc(OC)c1.
What is the InChIKey of 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine?
The InChIKey is WNKZWZLBYZKRLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O4S/c1-28-16-12-15(13-17(14-16)29-2)23-21-22(25-20-11-7-6-10-19(20)24-21)30(26,27)18-8-4-3-5-9-18/h3-14H,1-2H3,(H,23,24).
What are the key properties of 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine?
3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine has a molecular weight of 421.48 g/mol, XLogP of 4.22, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine is sourced from PubChem (CID 56680380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).