C18H21ClO5S2 — CID 56680435
(2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-methylsulfanylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56680435) has the molecular formula C18H21ClO5S2 and a molecular weight of 416.95 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-methylsulfanylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-methylsulfanylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56680435 |
| Molecular Formula | C18H21ClO5S2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-methylsulfanylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CSc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)sc2Cl)cc1 |
| InChI | InChI=1S/C18H21ClO5S2/c1-25-11-4-2-9(3-5-11)6-10-7-13(26-18(10)19)17-16(23)15(22)14(21)12(8-20)24-17/h2-5,7,12,14-17,20-23H,6,8H2,1H3/t12-,14-,15+,16-,17+/m1/s1 |
| InChIKey | OEHIDBCDQAUDJR-CMZRPVNOSA-N |
| XLogP | 2.23 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |