C17H28O5 — CID 56680590
(4R,14S)-14-methoxy-4-methyl-3,17-dioxabicyclo[14.1.0]heptadecane-2,15-dione (PubChem CID 56680590) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (4R,14S)-14-methoxy-4-methyl-3,17-dioxabicyclo[14.1.0]heptadecane-2,15-dione.
| Compound Name | (4R,14S)-14-methoxy-4-methyl-3,17-dioxabicyclo[14.1.0]heptadecane-2,15-dione |
|---|---|
| PubChem CID | 56680590 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (4R,14S)-14-methoxy-4-methyl-3,17-dioxabicyclo[14.1.0]heptadecane-2,15-dione |
| SMILES | CO[C@H]1CCCCCCCCC[C@@H](C)OC(=O)C2OC2C1=O |
| InChI | InChI=1S/C17H28O5/c1-12-10-8-6-4-3-5-7-9-11-13(20-2)14(18)15-16(22-15)17(19)21-12/h12-13,15-16H,3-11H2,1-2H3/t12-,13+,15?,16?/m1/s1 |
| InChIKey | VYIQZGUCEDELGZ-SQHUISNBSA-N |
| XLogP | 2.79 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|