C27H27NO7 — CID 56681504
1,6,8-trihydroxy-5-[5-(hydroxymethyl)-6-methyl-4-(methylamino)oxan-2-yl]-3-methylbenzo[a]anthracene-7,12-dione (PubChem CID 56681504) has the molecular formula C27H27NO7 and a molecular weight of 477.51 g/mol. Its IUPAC name is 1,6,8-trihydroxy-5-[5-(hydroxymethyl)-6-methyl-4-(methylamino)oxan-2-yl]-3-methylbenzo[a]anthracene-7,12-dione.
| Compound Name | 1,6,8-trihydroxy-5-[5-(hydroxymethyl)-6-methyl-4-(methylamino)oxan-2-yl]-3-methylbenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 56681504 |
| Molecular Formula | C27H27NO7 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 1,6,8-trihydroxy-5-[5-(hydroxymethyl)-6-methyl-4-(methylamino)oxan-2-yl]-3-methylbenzo[a]anthracene-7,12-dione |
| SMILES | CNC1CC(c2c(O)c3c(c4c(O)cc(C)cc24)C(=O)c2cccc(O)c2C3=O)OC(C)C1CO |
| InChI | InChI=1S/C27H27NO7/c1-11-7-14-20(18(31)8-11)23-24(26(33)21-13(25(23)32)5-4-6-17(21)30)27(34)22(14)19-9-16(28-3)15(10-29)12(2)35-19/h4-8,12,15-16,19,28-31,34H,9-10H2,1-3H3 |
| InChIKey | AQNPJKKYGQVMOS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_naphthol_A(2)', 'substructure': 'N/A'} |
|---|