C27H35N3O7 — CID 56681926
7-[4-[4-(2-methoxy-4-methylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid (PubChem CID 56681926) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is 7-[4-[4-(2-methoxy-4-methylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid.
| Compound Name | 7-[4-[4-(2-methoxy-4-methylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid |
|---|---|
| PubChem CID | 56681926 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 7-[4-[4-(2-methoxy-4-methylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid |
| SMILES | COc1cc(C)ccc1N1CCN(CCCCOc2ccc3c(c2)NC(=O)CC3)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H33N3O3.C2H2O4/c1-19-5-9-23(24(17-19)30-2)28-14-12-27(13-15-28)11-3-4-16-31-21-8-6-20-7-10-25(29)26-22(20)18-21;3-1(4)2(5)6/h5-6,8-9,17-18H,3-4,7,10-16H2,1-2H3,(H,26,29);(H,3,4)(H,5,6) |
| InChIKey | KQNQOTGDSHLFFV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|