About N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide
N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 56682067) has the molecular formula C18H12ClFN4O2S2
and a molecular weight of 434.91 g/mol. Its IUPAC name is N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide |
| PubChem CID | 56682067 |
| Molecular Formula | C18H12ClFN4O2S2 |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | Nc1nc2ccc(-c3cnc(Cl)c(NS(=O)(=O)c4ccc(F)cc4)c3)cc2s1 |
| InChI | InChI=1S/C18H12ClFN4O2S2/c19-17-15(24-28(25,26)13-4-2-12(20)3-5-13)7-11(9-22-17)10-1-6-14-16(8-10)27-18(21)23-14/h1-9,24H,(H2,21,23) |
| InChIKey | NCRYSHBHDZWERB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide?
The IUPAC name of N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide (CID 56682067) is N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide.
What is the SMILES notation for N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide?
The canonical SMILES for N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide is Nc1nc2ccc(-c3cnc(Cl)c(NS(=O)(=O)c4ccc(F)cc4)c3)cc2s1.
What is the InChIKey of N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide?
The InChIKey is NCRYSHBHDZWERB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClFN4O2S2/c19-17-15(24-28(25,26)13-4-2-12(20)3-5-13)7-11(9-22-17)10-1-6-14-16(8-10)27-18(21)23-14/h1-9,24H,(H2,21,23).
What are the key properties of N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide?
N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide has a molecular weight of 434.91 g/mol, XLogP of 4.53, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-chloro-3-pyridinyl]-4-fluorobenzenesulfonamide is sourced from PubChem (CID 56682067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).