C22H28FN3O5 — CID 56682218
4-[(5R,6S,9S,13S)-7-(4-fluoro-3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid (PubChem CID 56682218) has the molecular formula C22H28FN3O5 and a molecular weight of 433.48 g/mol. Its IUPAC name is 4-[(5R,6S,9S,13S)-7-(4-fluoro-3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid.
| Compound Name | 4-[(5R,6S,9S,13S)-7-(4-fluoro-3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
|---|---|
| PubChem CID | 56682218 |
| Molecular Formula | C22H28FN3O5 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-[(5R,6S,9S,13S)-7-(4-fluoro-3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
| SMILES | O=C(O)CCC[C@H]1[C@H]2CCCN3CCC[C@@H](CN1C(=O)c1ccc(F)c([N+](=O)[O-])c1)[C@@H]23 |
| InChI | InChI=1S/C22H28FN3O5/c23-17-9-8-14(12-19(17)26(30)31)22(29)25-13-15-4-2-10-24-11-3-5-16(21(15)24)18(25)6-1-7-20(27)28/h8-9,12,15-16,18,21H,1-7,10-11,13H2,(H,27,28)/t15-,16+,18-,21-/m0/s1 |
| InChIKey | TVOLDYLHCFBHEI-HPNQWNLUSA-N |
| XLogP | 3.30 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|