C20H23N3O2 — CID 56682320
1-benzyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]piperidin-4-amine (PubChem CID 56682320) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-benzyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]piperidin-4-amine.
| Compound Name | 1-benzyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 56682320 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-benzyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]piperidin-4-amine |
| SMILES | c1ccc(CN2CCC(NCc3coc(-c4ccco4)n3)CC2)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-2-5-16(6-3-1)14-23-10-8-17(9-11-23)21-13-18-15-25-20(22-18)19-7-4-12-24-19/h1-7,12,15,17,21H,8-11,13-14H2 |
| InChIKey | GXPUGIINTPAUIU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |