About N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine
N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine (PubChem CID 56682348) has the molecular formula C18H24N2O3
and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine.
Molecular Properties
| Compound Name | N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine |
| PubChem CID | 56682348 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine |
| SMILES | CCCCCC(C)NCc1coc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C18H24N2O3/c1-3-4-5-6-13(2)19-10-15-11-21-18(20-15)14-7-8-16-17(9-14)23-12-22-16/h7-9,11,13,19H,3-6,10,12H2,1-2H3 |
| InChIKey | JZTHUHLDOVOBCD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine?
The IUPAC name of N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine (CID 56682348) is N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine.
What is the SMILES notation for N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine?
The canonical SMILES for N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine is CCCCCC(C)NCc1coc(-c2ccc3c(c2)OCO3)n1.
What is the InChIKey of N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine?
The InChIKey is JZTHUHLDOVOBCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O3/c1-3-4-5-6-13(2)19-10-15-11-21-18(20-15)14-7-8-16-17(9-14)23-12-22-16/h7-9,11,13,19H,3-6,10,12H2,1-2H3.
What are the key properties of N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine?
N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine has a molecular weight of 316.40 g/mol, XLogP of 4.13, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(1,3-benzodioxol-5-yl)-1,3-oxazol-4-yl]methyl]heptan-2-amine is sourced from PubChem (CID 56682348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).