C23H22Cl2N2O — CID 56682539
N-[cyclohexyl-(3,4-dichlorophenyl)methyl]isoquinoline-6-carboxamide (PubChem CID 56682539) has the molecular formula C23H22Cl2N2O and a molecular weight of 413.35 g/mol. Its IUPAC name is N-[cyclohexyl-(3,4-dichlorophenyl)methyl]isoquinoline-6-carboxamide.
| Compound Name | N-[cyclohexyl-(3,4-dichlorophenyl)methyl]isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 56682539 |
| Molecular Formula | C23H22Cl2N2O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[cyclohexyl-(3,4-dichlorophenyl)methyl]isoquinoline-6-carboxamide |
| SMILES | O=C(NC(c1ccc(Cl)c(Cl)c1)C1CCCCC1)c1ccc2cnccc2c1 |
| InChI | InChI=1S/C23H22Cl2N2O/c24-20-9-8-17(13-21(20)25)22(15-4-2-1-3-5-15)27-23(28)18-6-7-19-14-26-11-10-16(19)12-18/h6-15,22H,1-5H2,(H,27,28) |
| InChIKey | ICGQHMCGZOGFPK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |