About N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide
N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide (PubChem CID 56682771) has the molecular formula C22H21N5OS
and a molecular weight of 403.51 g/mol. Its IUPAC name is N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide |
| PubChem CID | 56682771 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide |
| SMILES | N#Cc1ccc(C(c2cccnc2)N2CCC(NC(=O)c3nccs3)CC2)cc1 |
| InChI | InChI=1S/C22H21N5OS/c23-14-16-3-5-17(6-4-16)20(18-2-1-9-24-15-18)27-11-7-19(8-12-27)26-21(28)22-25-10-13-29-22/h1-6,9-10,13,15,19-20H,7-8,11-12H2,(H,26,28) |
| InChIKey | YHQOHGDDOIAZPT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide?
The IUPAC name of N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide (CID 56682771) is N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide is N#Cc1ccc(C(c2cccnc2)N2CCC(NC(=O)c3nccs3)CC2)cc1.
What is the InChIKey of N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide?
The InChIKey is YHQOHGDDOIAZPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N5OS/c23-14-16-3-5-17(6-4-16)20(18-2-1-9-24-15-18)27-11-7-19(8-12-27)26-21(28)22-25-10-13-29-22/h1-6,9-10,13,15,19-20H,7-8,11-12H2,(H,26,28).
What are the key properties of N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide?
N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide has a molecular weight of 403.51 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(4-cyanophenyl)-pyridin-3-ylmethyl]piperidin-4-yl]-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 56682771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).