C20H26O3 — CID 56683167
(6E,14E,15aS)-3,6,14-trimethyl-10-methylidene-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-2,11-dione (PubChem CID 56683167) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (6E,14E,15aS)-3,6,14-trimethyl-10-methylidene-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-2,11-dione.
| Compound Name | (6E,14E,15aS)-3,6,14-trimethyl-10-methylidene-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-2,11-dione |
|---|---|
| PubChem CID | 56683167 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (6E,14E,15aS)-3,6,14-trimethyl-10-methylidene-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-2,11-dione |
| SMILES | C=C1CC/C=C(\C)CCC2=C(C)C(=O)O[C@H]2/C=C(\C)CCC1=O |
| InChI | InChI=1S/C20H26O3/c1-13-6-5-7-15(3)18(21)11-9-14(2)12-19-17(10-8-13)16(4)20(22)23-19/h6,12,19H,3,5,7-11H2,1-2,4H3/b13-6+,14-12+/t19-/m0/s1 |
| InChIKey | XQEIHGLRZVLPOP-KBSDNRGFSA-N |
| XLogP | 4.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|