C25H37NO2 — CID 56683294
(2E,4E,6E,8E)-3,7-dimethyl-1-(1,4-oxazepan-4-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one (PubChem CID 56683294) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7-dimethyl-1-(1,4-oxazepan-4-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one.
| Compound Name | (2E,4E,6E,8E)-3,7-dimethyl-1-(1,4-oxazepan-4-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 56683294 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-1-(1,4-oxazepan-4-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)N2CCCOCC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H37NO2/c1-20(12-13-23-22(3)11-7-14-25(23,4)5)9-6-10-21(2)19-24(27)26-15-8-17-28-18-16-26/h6,9-10,12-13,19H,7-8,11,14-18H2,1-5H3/b10-6+,13-12+,20-9+,21-19+ |
| InChIKey | KZBDEJZVPIQGSN-YRJJDNPASA-N |
| XLogP | 5.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|