C25H36ClN7O — CID 56683336
3-[(1R,2R)-2-[[5-chloro-2-[(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]-1,1-dimethylurea (PubChem CID 56683336) has the molecular formula C25H36ClN7O and a molecular weight of 486.06 g/mol. Its IUPAC name is 3-[(1R,2R)-2-[[5-chloro-2-[(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]-1,1-dimethylurea.
| Compound Name | 3-[(1R,2R)-2-[[5-chloro-2-[(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 56683336 |
| Molecular Formula | C25H36ClN7O |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 3-[(1R,2R)-2-[[5-chloro-2-[(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]-1,1-dimethylurea |
| SMILES | CCN1CCc2ccc(Nc3ncc(Cl)c(N[C@@H]4CCCC[C@H]4NC(=O)N(C)C)n3)cc2CC1 |
| InChI | InChI=1S/C25H36ClN7O/c1-4-33-13-11-17-9-10-19(15-18(17)12-14-33)28-24-27-16-20(26)23(31-24)29-21-7-5-6-8-22(21)30-25(34)32(2)3/h9-10,15-16,21-22H,4-8,11-14H2,1-3H3,(H,30,34)(H2,27,28,29,31)/t21-,22-/m1/s1 |
| InChIKey | MIPFBSHTKYTXKN-FGZHOGPDSA-N |
| XLogP | 4.29 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |