C18H18N4O4 — CID 56683470
6-[2-(1H-imidazol-5-yl)ethyl]-4,11-dioxa-6,16-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9-triene-7,17-dione (PubChem CID 56683470) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 6-[2-(1H-imidazol-5-yl)ethyl]-4,11-dioxa-6,16-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9-triene-7,17-dione.
| Compound Name | 6-[2-(1H-imidazol-5-yl)ethyl]-4,11-dioxa-6,16-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9-triene-7,17-dione |
|---|---|
| PubChem CID | 56683470 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 6-[2-(1H-imidazol-5-yl)ethyl]-4,11-dioxa-6,16-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9-triene-7,17-dione |
| SMILES | O=C1c2cc3c(cc2OCN1CCc1cnc[nH]1)C(=O)N1CCCC1O3 |
| InChI | InChI=1S/C18H18N4O4/c23-17-12-7-15-13(18(24)22-4-1-2-16(22)26-15)6-14(12)25-10-21(17)5-3-11-8-19-9-20-11/h6-9,16H,1-5,10H2,(H,19,20) |
| InChIKey | GUQDPXBUGQUBOL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |