C14H9N5O3S — CID 56683495
3-(5-nitrofuran-2-yl)-6-phenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 56683495) has the molecular formula C14H9N5O3S and a molecular weight of 327.33 g/mol. Its IUPAC name is 3-(5-nitrofuran-2-yl)-6-phenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 3-(5-nitrofuran-2-yl)-6-phenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 56683495 |
| Molecular Formula | C14H9N5O3S |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-(5-nitrofuran-2-yl)-6-phenyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc3n2N=C(c2ccccc2)CS3)o1 |
| InChI | InChI=1S/C14H9N5O3S/c20-19(21)12-7-6-11(22-12)13-15-16-14-18(13)17-10(8-23-14)9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | PXWKQBDGFSYFAY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 99.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|