C20H29N3O6S2 — CID 56683541
(1S,5S,6R,9S,15E,20R)-5-hydroxy-20-methyl-6-prop-1-en-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone (PubChem CID 56683541) has the molecular formula C20H29N3O6S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is (1S,5S,6R,9S,15E,20R)-5-hydroxy-20-methyl-6-prop-1-en-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone.
| Compound Name | (1S,5S,6R,9S,15E,20R)-5-hydroxy-20-methyl-6-prop-1-en-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone |
|---|---|
| PubChem CID | 56683541 |
| Molecular Formula | C20H29N3O6S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (1S,5S,6R,9S,15E,20R)-5-hydroxy-20-methyl-6-prop-1-en-2-yl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone |
| SMILES | C=C(C)[C@H]1NC(=O)[C@H]2CSSCC/C=C/[C@H](CC(=O)N[C@H](C)C(=O)N2)OC(=O)C[C@@H]1O |
| InChI | InChI=1S/C20H29N3O6S2/c1-11(2)18-15(24)9-17(26)29-13-6-4-5-7-30-31-10-14(20(28)23-18)22-19(27)12(3)21-16(25)8-13/h4,6,12-15,18,24H,1,5,7-10H2,2-3H3,(H,21,25)(H,22,27)(H,23,28)/b6-4+/t12-,13-,14-,15+,18-/m1/s1 |
| InChIKey | YDUPENLJIUUIOU-HDXRNPEWSA-N |
| XLogP | 0.44 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|