C35H34N4O5 — CID 56683803
(2S)-2-[[4-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylmethoxybenzoyl]amino]-4-phenylbutanoic acid (PubChem CID 56683803) has the molecular formula C35H34N4O5 and a molecular weight of 590.68 g/mol. Its IUPAC name is (2S)-2-[[4-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylmethoxybenzoyl]amino]-4-phenylbutanoic acid.
| Compound Name | (2S)-2-[[4-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylmethoxybenzoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 56683803 |
| Molecular Formula | C35H34N4O5 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | (2S)-2-[[4-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylmethoxybenzoyl]amino]-4-phenylbutanoic acid |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)Nc1ccc(C(=O)N[C@@H](CCc2ccccc2)C(=O)O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C35H34N4O5/c36-28(19-26-21-37-29-14-8-7-13-27(26)29)34(41)38-30-18-16-25(20-32(30)44-22-24-11-5-2-6-12-24)33(40)39-31(35(42)43)17-15-23-9-3-1-4-10-23/h1-14,16,18,20-21,28,31,37H,15,17,19,22,36H2,(H,38,41)(H,39,40)(H,42,43)/t28-,31-/m0/s1 |
| InChIKey | WQPRMHIOJPNAMZ-IZEXYCQBSA-N |
| XLogP | 5.07 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |