C33H40N4O4 — CID 56683921
(2S)-2-[(2-phenoxybenzoyl)amino]-3-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-1-yl]propanoic acid (PubChem CID 56683921) has the molecular formula C33H40N4O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is (2S)-2-[(2-phenoxybenzoyl)amino]-3-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-1-yl]propanoic acid.
| Compound Name | (2S)-2-[(2-phenoxybenzoyl)amino]-3-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 56683921 |
| Molecular Formula | C33H40N4O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | (2S)-2-[(2-phenoxybenzoyl)amino]-3-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]triazol-1-yl]propanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/Cc1cn(C[C@H](NC(=O)c2ccccc2Oc2ccccc2)C(=O)O)nn1 |
| InChI | InChI=1S/C33H40N4O4/c1-24(2)12-10-13-25(3)14-11-15-26(4)20-21-27-22-37(36-35-27)23-30(33(39)40)34-32(38)29-18-8-9-19-31(29)41-28-16-6-5-7-17-28/h5-9,12,14,16-20,22,30H,10-11,13,15,21,23H2,1-4H3,(H,34,38)(H,39,40)/b25-14+,26-20+/t30-/m0/s1 |
| InChIKey | PFFJPRTXSCCLIU-DBZIORCRSA-N |
| XLogP | 6.92 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|