C29H43NO6 — CID 56684134
(4R,5S)-3-[(2R)-2-[(2S,3S,5S)-5-ethyl-5-[(2R,5R)-5-ethyl-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-3-methyloxolan-2-yl]butanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 56684134) has the molecular formula C29H43NO6 and a molecular weight of 501.66 g/mol. Its IUPAC name is (4R,5S)-3-[(2R)-2-[(2S,3S,5S)-5-ethyl-5-[(2R,5R)-5-ethyl-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-3-methyloxolan-2-yl]butanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(2R)-2-[(2S,3S,5S)-5-ethyl-5-[(2R,5R)-5-ethyl-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-3-methyloxolan-2-yl]butanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 56684134 |
| Molecular Formula | C29H43NO6 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | (4R,5S)-3-[(2R)-2-[(2S,3S,5S)-5-ethyl-5-[(2R,5R)-5-ethyl-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-3-methyloxolan-2-yl]butanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC[C@@H](C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H]1C)[C@H]1O[C@](CC)([C@H]2CC[C@](CC)([C@H](C)O)O2)C[C@@H]1C |
| InChI | InChI=1S/C29H43NO6/c1-7-22(26(32)30-19(5)25(34-27(30)33)21-13-11-10-12-14-21)24-18(4)17-29(9-3,36-24)23-15-16-28(8-2,35-23)20(6)31/h10-14,18-20,22-25,31H,7-9,15-17H2,1-6H3/t18-,19+,20-,22+,23+,24-,25+,28+,29-/m0/s1 |
| InChIKey | SYWOXCFBKCIFEM-VTYWIBJUSA-N |
| XLogP | 5.40 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |