About 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid
5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid (PubChem CID 56684149) has the molecular formula C5H9N2O6P
and a molecular weight of 224.11 g/mol. Its IUPAC name is 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid.
Molecular Properties
| Compound Name | 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid |
| PubChem CID | 56684149 |
| Molecular Formula | C5H9N2O6P |
| Molecular Weight | 224.11 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid |
| SMILES | Cc1c[nH]c(=O)[nH]c1=O.O=P(O)(O)O |
| InChI | InChI=1S/C5H6N2O2.H3O4P/c1-3-2-6-5(9)7-4(3)8;1-5(2,3)4/h2H,1H3,(H2,6,7,8,9);(H3,1,2,3,4) |
| InChIKey | ZKLKXUYJIUGECX-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.11 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid?
The IUPAC name of 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid (CID 56684149) is 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid.
What is the SMILES notation for 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid?
The canonical SMILES for 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid is Cc1c[nH]c(=O)[nH]c1=O.O=P(O)(O)O.
What is the InChIKey of 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid?
The InChIKey is ZKLKXUYJIUGECX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2.H3O4P/c1-3-2-6-5(9)7-4(3)8;1-5(2,3)4/h2H,1H3,(H2,6,7,8,9);(H3,1,2,3,4).
What are the key properties of 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid?
5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid has a molecular weight of 224.11 g/mol, XLogP of -1.56, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1H-pyrimidine-2,4-dione;phosphoric acid is sourced from PubChem (CID 56684149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).