C20H18N4O3 — CID 56684743
1-benzyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 56684743) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-benzyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 1-benzyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56684743 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-benzyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | Cc1nc(CN2C(=O)C(c3ccccc3)N(Cc3ccccc3)C2=O)no1 |
| InChI | InChI=1S/C20H18N4O3/c1-14-21-17(22-27-14)13-24-19(25)18(16-10-6-3-7-11-16)23(20(24)26)12-15-8-4-2-5-9-15/h2-11,18H,12-13H2,1H3 |
| InChIKey | DIERVERWJABEPD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|