About 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane
11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane (PubChem CID 566851) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane.
Molecular Properties
| Compound Name | 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane |
| PubChem CID | 566851 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane |
| SMILES | CN1CC2CC(C1)C1CCCCN1C2 |
| InChI | InChI=1S/C12H22N2/c1-13-7-10-6-11(9-13)12-4-2-3-5-14(12)8-10/h10-12H,2-9H2,1H3 |
| InChIKey | JHVZGAIDVLLSEV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane?
The IUPAC name of 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane (CID 566851) is 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane.
What is the SMILES notation for 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane?
The canonical SMILES for 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane is CN1CC2CC(C1)C1CCCCN1C2.
What is the InChIKey of 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane?
The InChIKey is JHVZGAIDVLLSEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-13-7-10-6-11(9-13)12-4-2-3-5-14(12)8-10/h10-12H,2-9H2,1H3.
What are the key properties of 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane?
11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane has a molecular weight of 194.32 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyl-7,11-diazatricyclo[7.3.1.02,7]tridecane is sourced from PubChem (CID 566851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).