About N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide
N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide (PubChem CID 56686331) has the molecular formula C13H16N2O2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide |
| PubChem CID | 56686331 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide |
| SMILES | CCNC(=O)C1(C)Sc2ccccc2N(C)C1=O |
| InChI | InChI=1S/C13H16N2O2S/c1-4-14-11(16)13(2)12(17)15(3)9-7-5-6-8-10(9)18-13/h5-8H,4H2,1-3H3,(H,14,16) |
| InChIKey | VBSMSMYXSJROMW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide?
The IUPAC name of N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide (CID 56686331) is N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide.
What is the SMILES notation for N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide?
The canonical SMILES for N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide is CCNC(=O)C1(C)Sc2ccccc2N(C)C1=O.
What is the InChIKey of N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide?
The InChIKey is VBSMSMYXSJROMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S/c1-4-14-11(16)13(2)12(17)15(3)9-7-5-6-8-10(9)18-13/h5-8H,4H2,1-3H3,(H,14,16).
What are the key properties of N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide?
N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide has a molecular weight of 264.35 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,4-dimethyl-3-oxo-1,4-benzothiazine-2-carboxamide is sourced from PubChem (CID 56686331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).