C10H12N2O4S — CID 56686615
3-(2,2-dimethoxyethyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 56686615) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-(2,2-dimethoxyethyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56686615 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-(2,2-dimethoxyethyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | COC(Cn1c(=O)[nH]c2ccsc2c1=O)OC |
| InChI | InChI=1S/C10H12N2O4S/c1-15-7(16-2)5-12-9(13)8-6(3-4-17-8)11-10(12)14/h3-4,7H,5H2,1-2H3,(H,11,14) |
| InChIKey | ZMTKRDTUUZGFJH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|