C13H13Cl3N4O2 — CID 56687818
N-[2,2,2-trichloro-1-[(2-methyl-4-oxoquinazolin-3-yl)amino]ethyl]acetamide (PubChem CID 56687818) has the molecular formula C13H13Cl3N4O2 and a molecular weight of 363.63 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(2-methyl-4-oxoquinazolin-3-yl)amino]ethyl]acetamide.
| Compound Name | N-[2,2,2-trichloro-1-[(2-methyl-4-oxoquinazolin-3-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 56687818 |
| Molecular Formula | C13H13Cl3N4O2 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(2-methyl-4-oxoquinazolin-3-yl)amino]ethyl]acetamide |
| SMILES | CC(=O)NC(Nn1c(C)nc2ccccc2c1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H13Cl3N4O2/c1-7-17-10-6-4-3-5-9(10)11(22)20(7)19-12(13(14,15)16)18-8(2)21/h3-6,12,19H,1-2H3,(H,18,21) |
| InChIKey | KKYWTPBAROIZPX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|