C10H7NS2 — CID 56687846
2,3-dithiatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-amine (PubChem CID 56687846) has the molecular formula C10H7NS2 and a molecular weight of 205.31 g/mol. Its IUPAC name is 2,3-dithiatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-amine.
| Compound Name | 2,3-dithiatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-amine |
|---|---|
| PubChem CID | 56687846 |
| Molecular Formula | C10H7NS2 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | 2,3-dithiatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-amine |
| SMILES | Nc1ccc2c3c(cccc13)SS2 |
| InChI | InChI=1S/C10H7NS2/c11-7-4-5-9-10-6(7)2-1-3-8(10)12-13-9/h1-5H,11H2 |
| InChIKey | LFPSRSQEEVITMR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|