C29H22N2O6 — CID 56688450
[2-benzoyloxy-4-[(E)-[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 56688450) has the molecular formula C29H22N2O6 and a molecular weight of 494.50 g/mol. Its IUPAC name is [2-benzoyloxy-4-[(E)-[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [2-benzoyloxy-4-[(E)-[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 56688450 |
| Molecular Formula | C29H22N2O6 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [2-benzoyloxy-4-[(E)-[(2-hydroxy-2-phenylacetyl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(/C=N/NC(=O)C(O)c2ccccc2)cc1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H22N2O6/c32-26(21-10-4-1-5-11-21)27(33)31-30-19-20-16-17-24(36-28(34)22-12-6-2-7-13-22)25(18-20)37-29(35)23-14-8-3-9-15-23/h1-19,26,32H,(H,31,33)/b30-19+ |
| InChIKey | RJMPKBCJTHZQIS-NDZAJKAJSA-N |
| XLogP | 4.31 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|