About 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one
1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one (PubChem CID 566885) has the molecular formula C24H47NO
and a molecular weight of 365.65 g/mol. Its IUPAC name is 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one |
| PubChem CID | 566885 |
| Molecular Formula | C24H47NO |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 365.37 |
| IUPAC Name | 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCN1CCCC1=O |
| InChI | InChI=1S/C24H47NO/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)17-19-25-18-9-16-24(25)26/h20-23H,6-19H2,1-5H3 |
| InChIKey | RHNZCEKSYRRAFB-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one?
The IUPAC name of 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one (CID 566885) is 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one.
What is the SMILES notation for 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one?
The canonical SMILES for 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one is CC(C)CCCC(C)CCCC(C)CCCC(C)CCN1CCCC1=O.
What is the InChIKey of 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one?
The InChIKey is RHNZCEKSYRRAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H47NO/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)17-19-25-18-9-16-24(25)26/h20-23H,6-19H2,1-5H3.
What are the key properties of 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one?
1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one has a molecular weight of 365.65 g/mol, XLogP of 7.07, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,7,11,15-tetramethylhexadecyl)pyrrolidin-2-one is sourced from PubChem (CID 566885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).