C15H13N3O4S2 — CID 56688833
3-acetyl-4-hydroxy-2-(2-methoxyphenyl)-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-2H-pyrrol-5-one (PubChem CID 56688833) has the molecular formula C15H13N3O4S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-acetyl-4-hydroxy-2-(2-methoxyphenyl)-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-2H-pyrrol-5-one.
| Compound Name | 3-acetyl-4-hydroxy-2-(2-methoxyphenyl)-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 56688833 |
| Molecular Formula | C15H13N3O4S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 3-acetyl-4-hydroxy-2-(2-methoxyphenyl)-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-2H-pyrrol-5-one |
| SMILES | COc1ccccc1C1C(C(C)=O)=C(O)C(=O)N1c1n[nH]c(=S)s1 |
| InChI | InChI=1S/C15H13N3O4S2/c1-7(19)10-11(8-5-3-4-6-9(8)22-2)18(13(21)12(10)20)14-16-17-15(23)24-14/h3-6,11,20H,1-2H3,(H,17,23) |
| InChIKey | YSQHPFFZJBQDFQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|