About 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane
3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane (PubChem CID 56689202) has the molecular formula C9H16N2O5
and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane.
Molecular Properties
| Compound Name | 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane |
| PubChem CID | 56689202 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane |
| SMILES | CCOC1CCC(C)([N+](=O)[O-])C1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N2O5/c1-4-16-7-5-6-8(2,10(12)13)9(7,3)11(14)15/h7H,4-6H2,1-3H3 |
| InChIKey | DOCFGWBVCNNGMY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane?
The IUPAC name of 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane (CID 56689202) is 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane.
What is the SMILES notation for 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane?
The canonical SMILES for 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane is CCOC1CCC(C)([N+](=O)[O-])C1(C)[N+](=O)[O-].
What is the InChIKey of 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane?
The InChIKey is DOCFGWBVCNNGMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O5/c1-4-16-7-5-6-8(2,10(12)13)9(7,3)11(14)15/h7H,4-6H2,1-3H3.
What are the key properties of 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane?
3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane has a molecular weight of 232.24 g/mol, XLogP of 1.26, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane is sourced from PubChem (CID 56689202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).