About 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione
4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione (PubChem CID 56690061) has the molecular formula C20H18N6O3
and a molecular weight of 390.40 g/mol. Its IUPAC name is 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione |
| PubChem CID | 56690061 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione |
| SMILES | Cc1c(/N=N/C2C(=O)NN(c3ccccc3)C2=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H18N6O3/c1-13-16(20(29)26(24(13)2)15-11-7-4-8-12-15)21-22-17-18(27)23-25(19(17)28)14-9-5-3-6-10-14/h3-12,17H,1-2H3,(H,23,27)/b22-21+ |
| InChIKey | MTEYYJNYFBVUHD-QURGRASLSA-N |
| XLogP | 2.01 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione?
The IUPAC name of 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione (CID 56690061) is 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione.
What is the SMILES notation for 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione?
The canonical SMILES for 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione is Cc1c(/N=N/C2C(=O)NN(c3ccccc3)C2=O)c(=O)n(-c2ccccc2)n1C.
What is the InChIKey of 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione?
The InChIKey is MTEYYJNYFBVUHD-QURGRASLSA-N. The full InChI is InChI=1S/C20H18N6O3/c1-13-16(20(29)26(24(13)2)15-11-7-4-8-12-15)21-22-17-18(27)23-25(19(17)28)14-9-5-3-6-10-14/h3-12,17H,1-2H3,(H,23,27)/b22-21+.
What are the key properties of 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione?
4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione has a molecular weight of 390.40 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)diazenyl]-1-phenylpyrazolidine-3,5-dione is sourced from PubChem (CID 56690061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).