C18H26N4O5 — CID 56690289
5,5-diethyl-1,3-bis[(2-oxopyrrolidin-1-yl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 56690289) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is 5,5-diethyl-1,3-bis[(2-oxopyrrolidin-1-yl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-diethyl-1,3-bis[(2-oxopyrrolidin-1-yl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 56690289 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 5,5-diethyl-1,3-bis[(2-oxopyrrolidin-1-yl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)N(CN2CCCC2=O)C(=O)N(CN2CCCC2=O)C1=O |
| InChI | InChI=1S/C18H26N4O5/c1-3-18(4-2)15(25)21(11-19-9-5-7-13(19)23)17(27)22(16(18)26)12-20-10-6-8-14(20)24/h3-12H2,1-2H3 |
| InChIKey | JAUIMCIANLIVOR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|