C28H26N4O3 — CID 56691183
N-[(E)-furan-2-ylmethylideneamino]-2-[[2-(tritylamino)acetyl]amino]acetamide (PubChem CID 56691183) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-[(E)-furan-2-ylmethylideneamino]-2-[[2-(tritylamino)acetyl]amino]acetamide.
| Compound Name | N-[(E)-furan-2-ylmethylideneamino]-2-[[2-(tritylamino)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 56691183 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-[(E)-furan-2-ylmethylideneamino]-2-[[2-(tritylamino)acetyl]amino]acetamide |
| SMILES | O=C(CNC(c1ccccc1)(c1ccccc1)c1ccccc1)NCC(=O)N/N=C/c1ccco1 |
| InChI | InChI=1S/C28H26N4O3/c33-26(29-20-27(34)32-31-19-25-17-10-18-35-25)21-30-28(22-11-4-1-5-12-22,23-13-6-2-7-14-23)24-15-8-3-9-16-24/h1-19,30H,20-21H2,(H,29,33)(H,32,34)/b31-19+ |
| InChIKey | YSALBAZVYWCAAV-ZCTHSVRISA-N |
| XLogP | 3.43 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|