About 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile
2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile (PubChem CID 56691774) has the molecular formula C21H21N3O
and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile |
| PubChem CID | 56691774 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)C(C(=O)C23CC4CC(CC(C4)C2)C3)C1c1cccnc1 |
| InChI | InChI=1S/C21H21N3O/c22-11-21(12-23)17(16-2-1-3-24-10-16)18(21)19(25)20-7-13-4-14(8-20)6-15(5-13)9-20/h1-3,10,13-15,17-18H,4-9H2 |
| InChIKey | JMUBASAFARRKDU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_cyano_B(3)', 'substructure': 'N/A'} |
|---|
Analyze 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile?
The IUPAC name of 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile (CID 56691774) is 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile.
What is the SMILES notation for 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile?
The canonical SMILES for 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile is N#CC1(C#N)C(C(=O)C23CC4CC(CC(C4)C2)C3)C1c1cccnc1.
What is the InChIKey of 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile?
The InChIKey is JMUBASAFARRKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O/c22-11-21(12-23)17(16-2-1-3-24-10-16)18(21)19(25)20-7-13-4-14(8-20)6-15(5-13)9-20/h1-3,10,13-15,17-18H,4-9H2.
What are the key properties of 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile?
2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile has a molecular weight of 331.42 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(adamantane-1-carbonyl)-3-pyridin-3-ylcyclopropane-1,1-dicarbonitrile is sourced from PubChem (CID 56691774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).