C21H16N4O6 — CID 56692594
N-[(E)-1-(furan-2-yl)-3-[2-(3-nitrobenzoyl)hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 56692594) has the molecular formula C21H16N4O6 and a molecular weight of 420.38 g/mol. Its IUPAC name is N-[(E)-1-(furan-2-yl)-3-[2-(3-nitrobenzoyl)hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(furan-2-yl)-3-[2-(3-nitrobenzoyl)hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 56692594 |
| Molecular Formula | C21H16N4O6 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[(E)-1-(furan-2-yl)-3-[2-(3-nitrobenzoyl)hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NNC(=O)c1cccc([N+](=O)[O-])c1)/C(=C\c1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H16N4O6/c26-19(14-6-2-1-3-7-14)22-18(13-17-10-5-11-31-17)21(28)24-23-20(27)15-8-4-9-16(12-15)25(29)30/h1-13H,(H,22,26)(H,23,27)(H,24,28)/b18-13+ |
| InChIKey | ZWTKSMZMRKNWDV-QGOAFFKASA-N |
| XLogP | 2.42 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|