About 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one
3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one (PubChem CID 56693023) has the molecular formula C21H27NO2
and a molecular weight of 325.45 g/mol. Its IUPAC name is 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one |
| PubChem CID | 56693023 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one |
| SMILES | CCCCc1c(O)c2c(n(-c3ccccc3)c1=O)CC(C)(C)CC2 |
| InChI | InChI=1S/C21H27NO2/c1-4-5-11-17-19(23)16-12-13-21(2,3)14-18(16)22(20(17)24)15-9-7-6-8-10-15/h6-10,23H,4-5,11-14H2,1-3H3 |
| InChIKey | BAWIOZXLWWGROM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one?
The IUPAC name of 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one (CID 56693023) is 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one.
What is the SMILES notation for 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one?
The canonical SMILES for 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one is CCCCc1c(O)c2c(n(-c3ccccc3)c1=O)CC(C)(C)CC2.
What is the InChIKey of 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one?
The InChIKey is BAWIOZXLWWGROM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO2/c1-4-5-11-17-19(23)16-12-13-21(2,3)14-18(16)22(20(17)24)15-9-7-6-8-10-15/h6-10,23H,4-5,11-14H2,1-3H3.
What are the key properties of 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one?
3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one has a molecular weight of 325.45 g/mol, XLogP of 4.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4-hydroxy-7,7-dimethyl-1-phenyl-6,8-dihydro-5H-quinolin-2-one is sourced from PubChem (CID 56693023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).