About N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide
N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide (PubChem CID 56693253) has the molecular formula C17H16N2S2
and a molecular weight of 312.46 g/mol. Its IUPAC name is N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide.
Molecular Properties
| Compound Name | N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide |
| PubChem CID | 56693253 |
| Molecular Formula | C17H16N2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide |
| SMILES | Cc1ccc(/N=C(\N=C2SCCS2)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N2S2/c1-13-7-9-15(10-8-13)18-16(14-5-3-2-4-6-14)19-17-20-11-12-21-17/h2-10H,11-12H2,1H3/b18-16- |
| InChIKey | UPBGRXRFTXBWSS-VLGSPTGOSA-N |
| XLogP | 4.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide?
The IUPAC name of N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide (CID 56693253) is N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide.
What is the SMILES notation for N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide?
The canonical SMILES for N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide is Cc1ccc(/N=C(\N=C2SCCS2)c2ccccc2)cc1.
What is the InChIKey of N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide?
The InChIKey is UPBGRXRFTXBWSS-VLGSPTGOSA-N. The full InChI is InChI=1S/C17H16N2S2/c1-13-7-9-15(10-8-13)18-16(14-5-3-2-4-6-14)19-17-20-11-12-21-17/h2-10H,11-12H2,1H3/b18-16-.
What are the key properties of N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide?
N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide has a molecular weight of 312.46 g/mol, XLogP of 4.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dithiolan-2-ylidene)-N'-(4-methylphenyl)benzenecarboximidamide is sourced from PubChem (CID 56693253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).