C13H13BrN2OS2 — CID 56693257
6-(4-bromophenyl)-3,3-dimethyl-5-sulfanylidene-1,7a-dihydroimidazo[1,5-c][1,3]thiazol-7-one (PubChem CID 56693257) has the molecular formula C13H13BrN2OS2 and a molecular weight of 357.30 g/mol. Its IUPAC name is 6-(4-bromophenyl)-3,3-dimethyl-5-sulfanylidene-1,7a-dihydroimidazo[1,5-c][1,3]thiazol-7-one.
| Compound Name | 6-(4-bromophenyl)-3,3-dimethyl-5-sulfanylidene-1,7a-dihydroimidazo[1,5-c][1,3]thiazol-7-one |
|---|---|
| PubChem CID | 56693257 |
| Molecular Formula | C13H13BrN2OS2 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 6-(4-bromophenyl)-3,3-dimethyl-5-sulfanylidene-1,7a-dihydroimidazo[1,5-c][1,3]thiazol-7-one |
| SMILES | CC1(C)SCC2C(=O)N(c3ccc(Br)cc3)C(=S)N21 |
| InChI | InChI=1S/C13H13BrN2OS2/c1-13(2)16-10(7-19-13)11(17)15(12(16)18)9-5-3-8(14)4-6-9/h3-6,10H,7H2,1-2H3 |
| InChIKey | RIZINOIRDKLCEC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|