About (9-oxofluoren-1-yl) trifluoromethanesulfonate
(9-oxofluoren-1-yl) trifluoromethanesulfonate (PubChem CID 56693717) has the molecular formula C14H7F3O4S
and a molecular weight of 328.27 g/mol. Its IUPAC name is (9-oxofluoren-1-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (9-oxofluoren-1-yl) trifluoromethanesulfonate |
| PubChem CID | 56693717 |
| Molecular Formula | C14H7F3O4S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | (9-oxofluoren-1-yl) trifluoromethanesulfonate |
| SMILES | O=C1c2ccccc2-c2cccc(OS(=O)(=O)C(F)(F)F)c21 |
| InChI | InChI=1S/C14H7F3O4S/c15-14(16,17)22(19,20)21-11-7-3-6-9-8-4-1-2-5-10(8)13(18)12(9)11/h1-7H |
| InChIKey | JMQLGXMNYYDCQY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (9-oxofluoren-1-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-oxofluoren-1-yl) trifluoromethanesulfonate?
The IUPAC name of (9-oxofluoren-1-yl) trifluoromethanesulfonate (CID 56693717) is (9-oxofluoren-1-yl) trifluoromethanesulfonate.
What is the SMILES notation for (9-oxofluoren-1-yl) trifluoromethanesulfonate?
The canonical SMILES for (9-oxofluoren-1-yl) trifluoromethanesulfonate is O=C1c2ccccc2-c2cccc(OS(=O)(=O)C(F)(F)F)c21.
What is the InChIKey of (9-oxofluoren-1-yl) trifluoromethanesulfonate?
The InChIKey is JMQLGXMNYYDCQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7F3O4S/c15-14(16,17)22(19,20)21-11-7-3-6-9-8-4-1-2-5-10(8)13(18)12(9)11/h1-7H.
What are the key properties of (9-oxofluoren-1-yl) trifluoromethanesulfonate?
(9-oxofluoren-1-yl) trifluoromethanesulfonate has a molecular weight of 328.27 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-oxofluoren-1-yl) trifluoromethanesulfonate is sourced from PubChem (CID 56693717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).