About (9,10-dioxoanthracen-1-yl) sulfite
(9,10-dioxoanthracen-1-yl) sulfite (PubChem CID 56693987) has the molecular formula C14H7O5S-
and a molecular weight of 287.27 g/mol. Its IUPAC name is (9,10-dioxoanthracen-1-yl) sulfite.
Molecular Properties
| Compound Name | (9,10-dioxoanthracen-1-yl) sulfite |
| PubChem CID | 56693987 |
| Molecular Formula | C14H7O5S- |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | (9,10-dioxoanthracen-1-yl) sulfite |
| SMILES | O=C1c2ccccc2C(=O)c2c(OS(=O)[O-])cccc21 |
| InChI | InChI=1S/C14H8O5S/c15-13-8-4-1-2-5-9(8)14(16)12-10(13)6-3-7-11(12)19-20(17)18/h1-7H,(H,17,18)/p-1 |
| InChIKey | DZSHTVHTBSJOKE-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (9,10-dioxoanthracen-1-yl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9,10-dioxoanthracen-1-yl) sulfite?
The IUPAC name of (9,10-dioxoanthracen-1-yl) sulfite (CID 56693987) is (9,10-dioxoanthracen-1-yl) sulfite.
What is the SMILES notation for (9,10-dioxoanthracen-1-yl) sulfite?
The canonical SMILES for (9,10-dioxoanthracen-1-yl) sulfite is O=C1c2ccccc2C(=O)c2c(OS(=O)[O-])cccc21.
What is the InChIKey of (9,10-dioxoanthracen-1-yl) sulfite?
The InChIKey is DZSHTVHTBSJOKE-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H8O5S/c15-13-8-4-1-2-5-9(8)14(16)12-10(13)6-3-7-11(12)19-20(17)18/h1-7H,(H,17,18)/p-1.
What are the key properties of (9,10-dioxoanthracen-1-yl) sulfite?
(9,10-dioxoanthracen-1-yl) sulfite has a molecular weight of 287.27 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (9,10-dioxoanthracen-1-yl) sulfite is sourced from PubChem (CID 56693987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).