C19H14O4 — CID 56695141
pentacyclo[8.4.4.111,14.01,10.03,8]nonadeca-3,5,7,12-tetraene-2,9,15,18-tetrone (PubChem CID 56695141) has the molecular formula C19H14O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is pentacyclo[8.4.4.111,14.01,10.03,8]nonadeca-3,5,7,12-tetraene-2,9,15,18-tetrone.
| Compound Name | pentacyclo[8.4.4.111,14.01,10.03,8]nonadeca-3,5,7,12-tetraene-2,9,15,18-tetrone |
|---|---|
| PubChem CID | 56695141 |
| Molecular Formula | C19H14O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | pentacyclo[8.4.4.111,14.01,10.03,8]nonadeca-3,5,7,12-tetraene-2,9,15,18-tetrone |
| SMILES | O=C1CCC(=O)C23C(=O)c4ccccc4C(=O)C12C1C=CC3C1 |
| InChI | InChI=1S/C19H14O4/c20-14-7-8-15(21)19-11-6-5-10(9-11)18(14,19)16(22)12-3-1-2-4-13(12)17(19)23/h1-6,10-11H,7-9H2 |
| InChIKey | SVLTZCQIVMCGII-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|