About 8-methylpyrido[1,2-a]pyrimidine-2,4-dione
8-methylpyrido[1,2-a]pyrimidine-2,4-dione (PubChem CID 56695261) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 8-methylpyrido[1,2-a]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 8-methylpyrido[1,2-a]pyrimidine-2,4-dione |
| PubChem CID | 56695261 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 8-methylpyrido[1,2-a]pyrimidine-2,4-dione |
| SMILES | CC1=CC2=NC(=O)CC(=O)N2C=C1 |
| InChI | InChI=1S/C9H8N2O2/c1-6-2-3-11-7(4-6)10-8(12)5-9(11)13/h2-4H,5H2,1H3 |
| InChIKey | YZEPPXWJRMSDLI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 8-methylpyrido[1,2-a]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylpyrido[1,2-a]pyrimidine-2,4-dione?
The IUPAC name of 8-methylpyrido[1,2-a]pyrimidine-2,4-dione (CID 56695261) is 8-methylpyrido[1,2-a]pyrimidine-2,4-dione.
What is the SMILES notation for 8-methylpyrido[1,2-a]pyrimidine-2,4-dione?
The canonical SMILES for 8-methylpyrido[1,2-a]pyrimidine-2,4-dione is CC1=CC2=NC(=O)CC(=O)N2C=C1.
What is the InChIKey of 8-methylpyrido[1,2-a]pyrimidine-2,4-dione?
The InChIKey is YZEPPXWJRMSDLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-6-2-3-11-7(4-6)10-8(12)5-9(11)13/h2-4H,5H2,1H3.
What are the key properties of 8-methylpyrido[1,2-a]pyrimidine-2,4-dione?
8-methylpyrido[1,2-a]pyrimidine-2,4-dione has a molecular weight of 176.17 g/mol, XLogP of 0.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylpyrido[1,2-a]pyrimidine-2,4-dione is sourced from PubChem (CID 56695261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).