C15H23N3 — CID 56695292
2,5-di(piperidin-1-yl)pyridine (PubChem CID 56695292) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2,5-di(piperidin-1-yl)pyridine.
| Compound Name | 2,5-di(piperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 56695292 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 2,5-di(piperidin-1-yl)pyridine |
| SMILES | c1cc(N2CCCCC2)ncc1N1CCCCC1 |
| InChI | InChI=1S/C15H23N3/c1-3-9-17(10-4-1)14-7-8-15(16-13-14)18-11-5-2-6-12-18/h7-8,13H,1-6,9-12H2 |
| InChIKey | UOSAMSHRCHGFOW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |