C21H15Cl2N3S — CID 56695910
3-benzhydrylsulfanyl-5-(2,4-dichlorophenyl)-1H-1,2,4-triazole (PubChem CID 56695910) has the molecular formula C21H15Cl2N3S and a molecular weight of 412.35 g/mol. Its IUPAC name is 3-benzhydrylsulfanyl-5-(2,4-dichlorophenyl)-1H-1,2,4-triazole.
| Compound Name | 3-benzhydrylsulfanyl-5-(2,4-dichlorophenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 56695910 |
| Molecular Formula | C21H15Cl2N3S |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 3-benzhydrylsulfanyl-5-(2,4-dichlorophenyl)-1H-1,2,4-triazole |
| SMILES | Clc1ccc(-c2nc(SC(c3ccccc3)c3ccccc3)n[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C21H15Cl2N3S/c22-16-11-12-17(18(23)13-16)20-24-21(26-25-20)27-19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,19H,(H,24,25,26) |
| InChIKey | GXDCMMCWYKXZRM-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |