About (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline
(11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline (PubChem CID 56696079) has the molecular formula C21H14N2S
and a molecular weight of 326.42 g/mol. Its IUPAC name is (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline.
Molecular Properties
| Compound Name | (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline |
| PubChem CID | 56696079 |
| Molecular Formula | C21H14N2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline |
| SMILES | Cc1ccc2c(c1)/C(=C/c1cccs1)c1nc3ccccc3nc1-2 |
| InChI | InChI=1S/C21H14N2S/c1-13-8-9-15-16(11-13)17(12-14-5-4-10-24-14)21-20(15)22-18-6-2-3-7-19(18)23-21/h2-12H,1H3/b17-12- |
| InChIKey | ZQIUIVASXGXDDM-ATVHPVEESA-N |
| XLogP | 5.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline?
The IUPAC name of (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline (CID 56696079) is (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline.
What is the SMILES notation for (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline?
The canonical SMILES for (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline is Cc1ccc2c(c1)/C(=C/c1cccs1)c1nc3ccccc3nc1-2.
What is the InChIKey of (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline?
The InChIKey is ZQIUIVASXGXDDM-ATVHPVEESA-N. The full InChI is InChI=1S/C21H14N2S/c1-13-8-9-15-16(11-13)17(12-14-5-4-10-24-14)21-20(15)22-18-6-2-3-7-19(18)23-21/h2-12H,1H3/b17-12-.
What are the key properties of (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline?
(11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline has a molecular weight of 326.42 g/mol, XLogP of 5.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (11Z)-2-methyl-11-(thiophen-2-ylmethylidene)indeno[1,2-b]quinoxaline is sourced from PubChem (CID 56696079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).