About N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine
N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine (PubChem CID 56696401) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine |
| PubChem CID | 56696401 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine |
| SMILES | CC1(C)C2CC(=NO)C(C)(n3ccnc3)C1C2 |
| InChI | InChI=1S/C13H19N3O/c1-12(2)9-6-10(12)13(3,11(7-9)15-17)16-5-4-14-8-16/h4-5,8-10,17H,6-7H2,1-3H3 |
| InChIKey | IHYPAVJPVIKBOY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine?
The IUPAC name of N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine (CID 56696401) is N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine.
What is the SMILES notation for N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine?
The canonical SMILES for N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine is CC1(C)C2CC(=NO)C(C)(n3ccnc3)C1C2.
What is the InChIKey of N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine?
The InChIKey is IHYPAVJPVIKBOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O/c1-12(2)9-6-10(12)13(3,11(7-9)15-17)16-5-4-14-8-16/h4-5,8-10,17H,6-7H2,1-3H3.
What are the key properties of N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine?
N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine has a molecular weight of 233.31 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-imidazol-1-yl-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)hydroxylamine is sourced from PubChem (CID 56696401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).