About (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene
(4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene (PubChem CID 56696911) has the molecular formula C12H13FN4
and a molecular weight of 232.26 g/mol. Its IUPAC name is (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene.
Molecular Properties
| Compound Name | (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene |
| PubChem CID | 56696911 |
| Molecular Formula | C12H13FN4 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene |
| SMILES | Cc1nn(C)c(C)c1/N=N/c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN4/c1-8-12(9(2)17(3)16-8)15-14-11-6-4-10(13)5-7-11/h4-7H,1-3H3/b15-14+ |
| InChIKey | KSXDIBMVXJNBQW-CCEZHUSRSA-N |
| XLogP | 3.59 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene?
The IUPAC name of (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene (CID 56696911) is (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene.
What is the SMILES notation for (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene?
The canonical SMILES for (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene is Cc1nn(C)c(C)c1/N=N/c1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene?
The InChIKey is KSXDIBMVXJNBQW-CCEZHUSRSA-N. The full InChI is InChI=1S/C12H13FN4/c1-8-12(9(2)17(3)16-8)15-14-11-6-4-10(13)5-7-11/h4-7H,1-3H3/b15-14+.
What are the key properties of (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene?
(4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene has a molecular weight of 232.26 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene is sourced from PubChem (CID 56696911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).