About 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one
2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 566977) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
| PubChem CID | 566977 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CC(=O)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C10H14O3/c1-6(11)9-7(12)4-10(2,3)5-8(9)13/h12H,4-5H2,1-3H3 |
| InChIKey | DIJDAMFZOHSRID-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one?
The IUPAC name of 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one (CID 566977) is 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one is CC(=O)C1=C(O)CC(C)(C)CC1=O.
What is the InChIKey of 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one?
The InChIKey is DIJDAMFZOHSRID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-6(11)9-7(12)4-10(2,3)5-8(9)13/h12H,4-5H2,1-3H3.
What are the key properties of 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one?
2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one has a molecular weight of 182.22 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 566977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).